C30H48O6 — CID 54182530
2-[(3aR,5S,6S,6aS)-5-(oxan-2-yloxy)-6-[3-(oxan-2-yloxy)oct-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]ethyl acetate (PubChem CID 54182530) has the molecular formula C30H48O6 and a molecular weight of 504.71 g/mol. Its IUPAC name is 2-[(3aR,5S,6S,6aS)-5-(oxan-2-yloxy)-6-[3-(oxan-2-yloxy)oct-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]ethyl acetate.
| Compound Name | 2-[(3aR,5S,6S,6aS)-5-(oxan-2-yloxy)-6-[3-(oxan-2-yloxy)oct-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]ethyl acetate |
|---|---|
| PubChem CID | 54182530 |
| Molecular Formula | C30H48O6 |
| Molecular Weight | 504.71 g/mol |
| Exact Mass | 504.35 |
| IUPAC Name | 2-[(3aR,5S,6S,6aS)-5-(oxan-2-yloxy)-6-[3-(oxan-2-yloxy)oct-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]ethyl acetate |
| SMILES | CCCCCC(C=C[C@H]1[C@H]2CC(CCOC(C)=O)=C[C@@H]2C[C@@H]1OC1CCCCO1)OC1CCCCO1 |
| InChI | InChI=1S/C30H48O6/c1-3-4-5-10-25(35-29-11-6-8-16-33-29)13-14-26-27-20-23(15-18-32-22(2)31)19-24(27)21-28(26)36-30-12-7-9-17-34-30/h13-14,19,24-30H,3-12,15-18,20-21H2,1-2H3/t24-,25?,26+,27+,28+,29?,30?/m1/s1 |
| InChIKey | PCVCDIBVEFCXQL-BWSAUENBSA-N |
| XLogP | 6.48 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.71 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|