C28H46O6 — CID 11754832
[(1R,2R,2'S,3aR,6aS)-2-(oxan-2-yloxy)-1-[(E,3S)-3-(oxan-2-yloxy)oct-1-enyl]spiro[2,3,3a,4,6,6a-hexahydro-1H-pentalene-5,3'-oxirane]-2'-yl]methanol (PubChem CID 11754832) has the molecular formula C28H46O6 and a molecular weight of 478.67 g/mol. Its IUPAC name is [(1R,2R,2'S,3aR,6aS)-2-(oxan-2-yloxy)-1-[(E,3S)-3-(oxan-2-yloxy)oct-1-enyl]spiro[2,3,3a,4,6,6a-hexahydro-1H-pentalene-5,3'-oxirane]-2'-yl]methanol.
| Compound Name | [(1R,2R,2'S,3aR,6aS)-2-(oxan-2-yloxy)-1-[(E,3S)-3-(oxan-2-yloxy)oct-1-enyl]spiro[2,3,3a,4,6,6a-hexahydro-1H-pentalene-5,3'-oxirane]-2'-yl]methanol |
|---|---|
| PubChem CID | 11754832 |
| Molecular Formula | C28H46O6 |
| Molecular Weight | 478.67 g/mol |
| Exact Mass | 478.33 |
| IUPAC Name | [(1R,2R,2'S,3aR,6aS)-2-(oxan-2-yloxy)-1-[(E,3S)-3-(oxan-2-yloxy)oct-1-enyl]spiro[2,3,3a,4,6,6a-hexahydro-1H-pentalene-5,3'-oxirane]-2'-yl]methanol |
| SMILES | CCCCC[C@@H](/C=C/[C@@H]1[C@H]2CC3(C[C@H]2C[C@H]1OC1CCCCO1)O[C@H]3CO)OC1CCCCO1 |
| InChI | InChI=1S/C28H46O6/c1-2-3-4-9-21(32-26-10-5-7-14-30-26)12-13-22-23-18-28(25(19-29)34-28)17-20(23)16-24(22)33-27-11-6-8-15-31-27/h12-13,20-27,29H,2-11,14-19H2,1H3/b13-12+/t20-,21+,22-,23+,24-,25+,26?,27?,28?/m1/s1 |
| InChIKey | ARSKPNIHMVORFE-MGMRBKRDSA-N |
| XLogP | 5.12 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.67 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|