C24H40O5 — CID 57290182
(1R,3R,4R)-2-methylidene-4-(oxan-2-yloxy)-3-[(3S)-3-(oxan-2-yloxy)oct-1-enyl]cyclopentan-1-ol (PubChem CID 57290182) has the molecular formula C24H40O5 and a molecular weight of 408.58 g/mol. Its IUPAC name is (1R,3R,4R)-2-methylidene-4-(oxan-2-yloxy)-3-[(3S)-3-(oxan-2-yloxy)oct-1-enyl]cyclopentan-1-ol.
| Compound Name | (1R,3R,4R)-2-methylidene-4-(oxan-2-yloxy)-3-[(3S)-3-(oxan-2-yloxy)oct-1-enyl]cyclopentan-1-ol |
|---|---|
| PubChem CID | 57290182 |
| Molecular Formula | C24H40O5 |
| Molecular Weight | 408.58 g/mol |
| Exact Mass | 408.29 |
| IUPAC Name | (1R,3R,4R)-2-methylidene-4-(oxan-2-yloxy)-3-[(3S)-3-(oxan-2-yloxy)oct-1-enyl]cyclopentan-1-ol |
| SMILES | C=C1[C@H](O)C[C@@H](OC2CCCCO2)[C@@H]1C=C[C@H](CCCCC)OC1CCCCO1 |
| InChI | InChI=1S/C24H40O5/c1-3-4-5-10-19(28-23-11-6-8-15-26-23)13-14-20-18(2)21(25)17-22(20)29-24-12-7-9-16-27-24/h13-14,19-25H,2-12,15-17H2,1H3/t19-,20+,21+,22+,23?,24?/m0/s1 |
| InChIKey | ALAQHJMHEUTNMZ-IZLBHYSDSA-N |
| XLogP | 4.88 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.58 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|