C25H39FO6 — CID 57160708
(3S,3aS,4R,5R,6aS)-3-fluoro-4-(oxan-2-yloxy)-5-[(3S)-3-(oxan-2-yloxy)oct-1-enyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one (PubChem CID 57160708) has the molecular formula C25H39FO6 and a molecular weight of 454.58 g/mol. Its IUPAC name is (3S,3aS,4R,5R,6aS)-3-fluoro-4-(oxan-2-yloxy)-5-[(3S)-3-(oxan-2-yloxy)oct-1-enyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one.
| Compound Name | (3S,3aS,4R,5R,6aS)-3-fluoro-4-(oxan-2-yloxy)-5-[(3S)-3-(oxan-2-yloxy)oct-1-enyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
|---|---|
| PubChem CID | 57160708 |
| Molecular Formula | C25H39FO6 |
| Molecular Weight | 454.58 g/mol |
| Exact Mass | 454.27 |
| IUPAC Name | (3S,3aS,4R,5R,6aS)-3-fluoro-4-(oxan-2-yloxy)-5-[(3S)-3-(oxan-2-yloxy)oct-1-enyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
| SMILES | CCCCC[C@@H](C=C[C@H]1C[C@@H]2OC(=O)[C@@H](F)[C@@H]2[C@@H]1OC1CCCCO1)OC1CCCCO1 |
| InChI | InChI=1S/C25H39FO6/c1-2-3-4-9-18(30-20-10-5-7-14-28-20)13-12-17-16-19-22(23(26)25(27)31-19)24(17)32-21-11-6-8-15-29-21/h12-13,17-24H,2-11,14-16H2,1H3/t17-,18-,19-,20?,21?,22+,23-,24+/m0/s1 |
| InChIKey | MUQQTBOLDHTJOY-CFHBPPOQSA-N |
| XLogP | 4.85 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.58 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|