C28H56O2Sn — CID 67865469
tributyl-[3-(oxan-2-yloxy)undec-1-enyl]stannane (PubChem CID 67865469) has the molecular formula C28H56O2Sn and a molecular weight of 543.47 g/mol. Its IUPAC name is tributyl-[3-(oxan-2-yloxy)undec-1-enyl]stannane.
| Compound Name | tributyl-[3-(oxan-2-yloxy)undec-1-enyl]stannane |
|---|---|
| PubChem CID | 67865469 |
| Molecular Formula | C28H56O2Sn |
| Molecular Weight | 543.47 g/mol |
| Exact Mass | 544.33 |
| IUPAC Name | tributyl-[3-(oxan-2-yloxy)undec-1-enyl]stannane |
| SMILES | CCCCCCCCC(C=C[Sn](CCCC)(CCCC)CCCC)OC1CCCCO1 |
| InChI | InChI=1S/C16H29O2.3C4H9.Sn/c1-3-5-6-7-8-9-12-15(4-2)18-16-13-10-11-14-17-16;3*1-3-4-2;/h2,4,15-16H,3,5-14H2,1H3;3*1,3-4H2,2H3; |
| InChIKey | YPQUKMIOFKOXFT-UHFFFAOYSA-N |
| XLogP | 9.59 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.47 |
| LogP ≤ 5 | 9.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|