C22H34O7 — CID 70593471
[(1S,2S)-2-acetyloxy-5-hydroxy-3-[3-(oxan-2-yloxy)oct-1-enyl]cyclopent-3-en-1-yl] acetate (PubChem CID 70593471) has the molecular formula C22H34O7 and a molecular weight of 410.51 g/mol. Its IUPAC name is [(1S,2S)-2-acetyloxy-5-hydroxy-3-[3-(oxan-2-yloxy)oct-1-enyl]cyclopent-3-en-1-yl] acetate.
| Compound Name | [(1S,2S)-2-acetyloxy-5-hydroxy-3-[3-(oxan-2-yloxy)oct-1-enyl]cyclopent-3-en-1-yl] acetate |
|---|---|
| PubChem CID | 70593471 |
| Molecular Formula | C22H34O7 |
| Molecular Weight | 410.51 g/mol |
| Exact Mass | 410.23 |
| IUPAC Name | [(1S,2S)-2-acetyloxy-5-hydroxy-3-[3-(oxan-2-yloxy)oct-1-enyl]cyclopent-3-en-1-yl] acetate |
| SMILES | CCCCCC(C=CC1=CC(O)[C@H](OC(C)=O)[C@H]1OC(C)=O)OC1CCCCO1 |
| InChI | InChI=1S/C22H34O7/c1-4-5-6-9-18(29-20-10-7-8-13-26-20)12-11-17-14-19(25)22(28-16(3)24)21(17)27-15(2)23/h11-12,14,18-22,25H,4-10,13H2,1-3H3/t18?,19?,20?,21-,22-/m0/s1 |
| InChIKey | IPOAAOFWZFXMIC-IOHZUATHSA-N |
| XLogP | 3.20 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.51 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|