C25H38O5 — CID 70458815
(Z)-7-[(1S,5R)-5-[(E,3R)-3-(oxan-2-yloxy)oct-1-enyl]-4-oxocyclopent-2-en-1-yl]hept-5-enoic acid (PubChem CID 70458815) has the molecular formula C25H38O5 and a molecular weight of 418.57 g/mol. Its IUPAC name is (Z)-7-[(1S,5R)-5-[(E,3R)-3-(oxan-2-yloxy)oct-1-enyl]-4-oxocyclopent-2-en-1-yl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(1S,5R)-5-[(E,3R)-3-(oxan-2-yloxy)oct-1-enyl]-4-oxocyclopent-2-en-1-yl]hept-5-enoic acid |
|---|---|
| PubChem CID | 70458815 |
| Molecular Formula | C25H38O5 |
| Molecular Weight | 418.57 g/mol |
| Exact Mass | 418.27 |
| IUPAC Name | (Z)-7-[(1S,5R)-5-[(E,3R)-3-(oxan-2-yloxy)oct-1-enyl]-4-oxocyclopent-2-en-1-yl]hept-5-enoic acid |
| SMILES | CCCCC[C@H](/C=C/[C@H]1C(=O)C=C[C@@H]1C/C=C\CCCC(=O)O)OC1CCCCO1 |
| InChI | InChI=1S/C25H38O5/c1-2-3-6-12-21(30-25-14-9-10-19-29-25)16-17-22-20(15-18-23(22)26)11-7-4-5-8-13-24(27)28/h4,7,15-18,20-22,25H,2-3,5-6,8-14,19H2,1H3,(H,27,28)/b7-4-,17-16+/t20-,21+,22+,25?/m0/s1 |
| InChIKey | RXUGXQLHKYQOSK-LCKFJWBJSA-N |
| XLogP | 5.61 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.57 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|