C25H36O5 — CID 70588280
(Z)-7-[(1R,2R)-2-[(E,3S)-3-(oxan-2-yloxy)oct-1-en-6-ynyl]-5-oxocyclopentyl]hept-5-enoic acid (PubChem CID 70588280) has the molecular formula C25H36O5 and a molecular weight of 416.56 g/mol. Its IUPAC name is (Z)-7-[(1R,2R)-2-[(E,3S)-3-(oxan-2-yloxy)oct-1-en-6-ynyl]-5-oxocyclopentyl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(1R,2R)-2-[(E,3S)-3-(oxan-2-yloxy)oct-1-en-6-ynyl]-5-oxocyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 70588280 |
| Molecular Formula | C25H36O5 |
| Molecular Weight | 416.56 g/mol |
| Exact Mass | 416.26 |
| IUPAC Name | (Z)-7-[(1R,2R)-2-[(E,3S)-3-(oxan-2-yloxy)oct-1-en-6-ynyl]-5-oxocyclopentyl]hept-5-enoic acid |
| SMILES | CC#CCC[C@@H](/C=C/[C@H]1CCC(=O)[C@@H]1C/C=C\CCCC(=O)O)OC1CCCCO1 |
| InChI | InChI=1S/C25H36O5/c1-2-3-6-11-21(30-25-14-9-10-19-29-25)17-15-20-16-18-23(26)22(20)12-7-4-5-8-13-24(27)28/h4,7,15,17,20-22,25H,5-6,8-14,16,18-19H2,1H3,(H,27,28)/b7-4-,17-15+/t20-,21-,22+,25?/m0/s1 |
| InChIKey | HCRSCGUIWJIGTM-KKZXPEHFSA-N |
| XLogP | 5.05 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.56 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|