C20H32O4 — CID 21403780
(E)-6-[2-[(E)-3-hydroxynon-1-enyl]-5-oxocyclopentyl]hex-4-enoic acid (PubChem CID 21403780) has the molecular formula C20H32O4 and a molecular weight of 336.47 g/mol. Its IUPAC name is (E)-6-[2-[(E)-3-hydroxynon-1-enyl]-5-oxocyclopentyl]hex-4-enoic acid.
| Compound Name | (E)-6-[2-[(E)-3-hydroxynon-1-enyl]-5-oxocyclopentyl]hex-4-enoic acid |
|---|---|
| PubChem CID | 21403780 |
| Molecular Formula | C20H32O4 |
| Molecular Weight | 336.47 g/mol |
| Exact Mass | 336.23 |
| IUPAC Name | (E)-6-[2-[(E)-3-hydroxynon-1-enyl]-5-oxocyclopentyl]hex-4-enoic acid |
| SMILES | CCCCCCC(O)/C=C/C1CCC(=O)C1C/C=C/CCC(=O)O |
| InChI | InChI=1S/C20H32O4/c1-2-3-4-6-9-17(21)14-12-16-13-15-19(22)18(16)10-7-5-8-11-20(23)24/h5,7,12,14,16-18,21H,2-4,6,8-11,13,15H2,1H3,(H,23,24)/b7-5+,14-12+ |
| InChIKey | KEVQNRSRKDYVIU-BGUVSGJASA-N |
| XLogP | 4.28 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.47 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|