C21H36O3 — CID 57296071
trans-(2R,3R)-2-(8,8-dihydroxyoct-2-enyl)-3-oct-1-enylcyclopentan-1-one (PubChem CID 57296071) has the molecular formula C21H36O3 and a molecular weight of 336.52 g/mol. Its IUPAC name is trans-(2R,3R)-2-(8,8-dihydroxyoct-2-enyl)-3-oct-1-enylcyclopentan-1-one.
| Compound Name | trans-(2R,3R)-2-(8,8-dihydroxyoct-2-enyl)-3-oct-1-enylcyclopentan-1-one |
|---|---|
| PubChem CID | 57296071 |
| Molecular Formula | C21H36O3 |
| Molecular Weight | 336.52 g/mol |
| Exact Mass | 336.27 |
| IUPAC Name | trans-(2R,3R)-2-(8,8-dihydroxyoct-2-enyl)-3-oct-1-enylcyclopentan-1-one |
| SMILES | CCCCCCC=C[C@H]1CCC(=O)[C@@H]1CC=CCCCCC(O)O |
| InChI | InChI=1S/C21H36O3/c1-2-3-4-5-7-10-13-18-16-17-20(22)19(18)14-11-8-6-9-12-15-21(23)24/h8,10-11,13,18-19,21,23-24H,2-7,9,12,14-17H2,1H3/t18-,19+/m0/s1 |
| InChIKey | FSFRPDIYTQTGFX-RBUKOAKNSA-N |
| XLogP | 4.93 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.52 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|