C25H40O3 — CID 57128136
trans-(2R,3R)-3-(4-ethenyldec-1-enyl)-2-(8-hydroxy-7-oxooct-2-enyl)cyclopentan-1-one (PubChem CID 57128136) has the molecular formula C25H40O3 and a molecular weight of 388.59 g/mol. Its IUPAC name is trans-(2R,3R)-3-(4-ethenyldec-1-enyl)-2-(8-hydroxy-7-oxooct-2-enyl)cyclopentan-1-one.
| Compound Name | trans-(2R,3R)-3-(4-ethenyldec-1-enyl)-2-(8-hydroxy-7-oxooct-2-enyl)cyclopentan-1-one |
|---|---|
| PubChem CID | 57128136 |
| Molecular Formula | C25H40O3 |
| Molecular Weight | 388.59 g/mol |
| Exact Mass | 388.30 |
| IUPAC Name | trans-(2R,3R)-3-(4-ethenyldec-1-enyl)-2-(8-hydroxy-7-oxooct-2-enyl)cyclopentan-1-one |
| SMILES | C=CC(CC=C[C@H]1CCC(=O)[C@@H]1CC=CCCCC(=O)CO)CCCCCC |
| InChI | InChI=1S/C25H40O3/c1-3-5-6-9-13-21(4-2)14-12-15-22-18-19-25(28)24(22)17-11-8-7-10-16-23(27)20-26/h4,8,11-12,15,21-22,24,26H,2-3,5-7,9-10,13-14,16-20H2,1H3/t21?,22-,24+/m0/s1 |
| InChIKey | MMLBHKZOAOTKSK-ZBKSJXDOSA-N |
| XLogP | 5.98 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.59 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|