C23H34O4 — CID 54114086
trans-(2R,3R)-3-(4-ethynyl-4-hydroxyoct-1-enyl)-2-(8-hydroxy-7-oxooct-2-enyl)cyclopentan-1-one (PubChem CID 54114086) has the molecular formula C23H34O4 and a molecular weight of 374.52 g/mol. Its IUPAC name is trans-(2R,3R)-3-(4-ethynyl-4-hydroxyoct-1-enyl)-2-(8-hydroxy-7-oxooct-2-enyl)cyclopentan-1-one.
| Compound Name | trans-(2R,3R)-3-(4-ethynyl-4-hydroxyoct-1-enyl)-2-(8-hydroxy-7-oxooct-2-enyl)cyclopentan-1-one |
|---|---|
| PubChem CID | 54114086 |
| Molecular Formula | C23H34O4 |
| Molecular Weight | 374.52 g/mol |
| Exact Mass | 374.25 |
| IUPAC Name | trans-(2R,3R)-3-(4-ethynyl-4-hydroxyoct-1-enyl)-2-(8-hydroxy-7-oxooct-2-enyl)cyclopentan-1-one |
| SMILES | C#CC(O)(CC=C[C@H]1CCC(=O)[C@@H]1CC=CCCCC(=O)CO)CCCC |
| InChI | InChI=1S/C23H34O4/c1-3-5-16-23(27,4-2)17-10-11-19-14-15-22(26)21(19)13-9-7-6-8-12-20(25)18-24/h2,7,9-11,19,21,24,27H,3,5-6,8,12-18H2,1H3/t19-,21+,23?/m0/s1 |
| InChIKey | NJCWSERGRFCMJG-ZPVUCFGCSA-N |
| XLogP | 3.76 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.52 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|