C21H34O3 — CID 57322756
trans-(2R,3R)-2-hept-2-enyl-3-[4-hydroxy-4-(hydroxymethyl)octa-1,5-dienyl]cyclopentan-1-one (PubChem CID 57322756) has the molecular formula C21H34O3 and a molecular weight of 334.50 g/mol. Its IUPAC name is trans-(2R,3R)-2-hept-2-enyl-3-[4-hydroxy-4-(hydroxymethyl)octa-1,5-dienyl]cyclopentan-1-one.
| Compound Name | trans-(2R,3R)-2-hept-2-enyl-3-[4-hydroxy-4-(hydroxymethyl)octa-1,5-dienyl]cyclopentan-1-one |
|---|---|
| PubChem CID | 57322756 |
| Molecular Formula | C21H34O3 |
| Molecular Weight | 334.50 g/mol |
| Exact Mass | 334.25 |
| IUPAC Name | trans-(2R,3R)-2-hept-2-enyl-3-[4-hydroxy-4-(hydroxymethyl)octa-1,5-dienyl]cyclopentan-1-one |
| SMILES | CCC=CC(O)(CO)CC=C[C@H]1CCC(=O)[C@@H]1CC=CCCCC |
| InChI | InChI=1S/C21H34O3/c1-3-5-7-8-9-12-19-18(13-14-20(19)23)11-10-16-21(24,17-22)15-6-4-2/h6,8-11,15,18-19,22,24H,3-5,7,12-14,16-17H2,1-2H3/t18-,19+,21?/m0/s1 |
| InChIKey | GEHFGARJCFDMLV-KTVLMBSMSA-N |
| XLogP | 4.35 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.50 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|