C26H40O4 — CID 54447096
ethyl 7-[(1R,2R)-2-(4-ethynyl-4-hydroxydec-1-enyl)-5-oxocyclopentyl]hept-5-enoate (PubChem CID 54447096) has the molecular formula C26H40O4 and a molecular weight of 416.60 g/mol. Its IUPAC name is ethyl 7-[(1R,2R)-2-(4-ethynyl-4-hydroxydec-1-enyl)-5-oxocyclopentyl]hept-5-enoate.
| Compound Name | ethyl 7-[(1R,2R)-2-(4-ethynyl-4-hydroxydec-1-enyl)-5-oxocyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 54447096 |
| Molecular Formula | C26H40O4 |
| Molecular Weight | 416.60 g/mol |
| Exact Mass | 416.29 |
| IUPAC Name | ethyl 7-[(1R,2R)-2-(4-ethynyl-4-hydroxydec-1-enyl)-5-oxocyclopentyl]hept-5-enoate |
| SMILES | C#CC(O)(CC=C[C@H]1CCC(=O)[C@@H]1CC=CCCCC(=O)OCC)CCCCCC |
| InChI | InChI=1S/C26H40O4/c1-4-7-8-13-20-26(29,5-2)21-14-15-22-18-19-24(27)23(22)16-11-9-10-12-17-25(28)30-6-3/h2,9,11,14-15,22-23,29H,4,6-8,10,12-13,16-21H2,1,3H3/t22-,23+,26?/m0/s1 |
| InChIKey | WSHBHPDOWPTBNJ-MXKXXCEUSA-N |
| XLogP | 5.54 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.60 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|