C22H30O4 — CID 57305316
7-[(1R,2S)-2-(4-ethynyl-4-hydroxyoct-1-enyl)-5-oxocyclopent-3-en-1-yl]hept-5-enoic acid (PubChem CID 57305316) has the molecular formula C22H30O4 and a molecular weight of 358.48 g/mol. Its IUPAC name is 7-[(1R,2S)-2-(4-ethynyl-4-hydroxyoct-1-enyl)-5-oxocyclopent-3-en-1-yl]hept-5-enoic acid.
| Compound Name | 7-[(1R,2S)-2-(4-ethynyl-4-hydroxyoct-1-enyl)-5-oxocyclopent-3-en-1-yl]hept-5-enoic acid |
|---|---|
| PubChem CID | 57305316 |
| Molecular Formula | C22H30O4 |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.21 |
| IUPAC Name | 7-[(1R,2S)-2-(4-ethynyl-4-hydroxyoct-1-enyl)-5-oxocyclopent-3-en-1-yl]hept-5-enoic acid |
| SMILES | C#CC(O)(CC=C[C@H]1C=CC(=O)[C@@H]1CC=CCCCC(=O)O)CCCC |
| InChI | InChI=1S/C22H30O4/c1-3-5-16-22(26,4-2)17-10-11-18-14-15-20(23)19(18)12-8-6-7-9-13-21(24)25/h2,6,8,10-11,14-15,18-19,26H,3,5,7,9,12-13,16-17H2,1H3,(H,24,25)/t18-,19+,22?/m0/s1 |
| InChIKey | MKMCBQTYXBUKOM-ZKTCVHQMSA-N |
| XLogP | 4.06 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|