C23H34O4 — CID 70583931
(Z)-7-[(1R,2S)-2-(4-ethenyl-4-hydroxynon-1-enyl)-5-oxocyclopent-3-en-1-yl]hept-5-enoic acid (PubChem CID 70583931) has the molecular formula C23H34O4 and a molecular weight of 374.52 g/mol. Its IUPAC name is (Z)-7-[(1R,2S)-2-(4-ethenyl-4-hydroxynon-1-enyl)-5-oxocyclopent-3-en-1-yl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(1R,2S)-2-(4-ethenyl-4-hydroxynon-1-enyl)-5-oxocyclopent-3-en-1-yl]hept-5-enoic acid |
|---|---|
| PubChem CID | 70583931 |
| Molecular Formula | C23H34O4 |
| Molecular Weight | 374.52 g/mol |
| Exact Mass | 374.25 |
| IUPAC Name | (Z)-7-[(1R,2S)-2-(4-ethenyl-4-hydroxynon-1-enyl)-5-oxocyclopent-3-en-1-yl]hept-5-enoic acid |
| SMILES | C=CC(O)(CC=C[C@H]1C=CC(=O)[C@@H]1C/C=C\CCCC(=O)O)CCCCC |
| InChI | InChI=1S/C23H34O4/c1-3-5-10-17-23(27,4-2)18-11-12-19-15-16-21(24)20(19)13-8-6-7-9-14-22(25)26/h4,6,8,11-12,15-16,19-20,27H,2-3,5,7,9-10,13-14,17-18H2,1H3,(H,25,26)/b8-6-,12-11?/t19-,20+,23?/m0/s1 |
| InChIKey | TVHAIIGZODNEEY-YMHVQWJFSA-N |
| XLogP | 5.00 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.52 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|