C24H40O2 — CID 70418520
(4S,5R)-4-(4-ethenyl-4-hydroxydec-1-enyl)-5-heptylcyclopent-2-en-1-one (PubChem CID 70418520) has the molecular formula C24H40O2 and a molecular weight of 360.58 g/mol. Its IUPAC name is (4S,5R)-4-(4-ethenyl-4-hydroxydec-1-enyl)-5-heptylcyclopent-2-en-1-one.
| Compound Name | (4S,5R)-4-(4-ethenyl-4-hydroxydec-1-enyl)-5-heptylcyclopent-2-en-1-one |
|---|---|
| PubChem CID | 70418520 |
| Molecular Formula | C24H40O2 |
| Molecular Weight | 360.58 g/mol |
| Exact Mass | 360.30 |
| IUPAC Name | (4S,5R)-4-(4-ethenyl-4-hydroxydec-1-enyl)-5-heptylcyclopent-2-en-1-one |
| SMILES | C=CC(O)(CC=C[C@H]1C=CC(=O)[C@@H]1CCCCCCC)CCCCCC |
| InChI | InChI=1S/C24H40O2/c1-4-7-9-11-12-16-22-21(17-18-23(22)25)15-14-20-24(26,6-3)19-13-10-8-5-2/h6,14-15,17-18,21-22,26H,3-5,7-13,16,19-20H2,1-2H3/t21-,22+,24?/m0/s1 |
| InChIKey | NNCWJKVQWGTTCO-JCVDRHSJSA-N |
| XLogP | 6.55 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.58 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|