C24H44O4 — CID 54040042
(1S,3R,4R,5R)-4-(4-ethenyl-4-hydroxydec-1-enyl)-5-(7-hydroxyheptyl)cyclopentane-1,3-diol (PubChem CID 54040042) has the molecular formula C24H44O4 and a molecular weight of 396.61 g/mol. Its IUPAC name is (1S,3R,4R,5R)-4-(4-ethenyl-4-hydroxydec-1-enyl)-5-(7-hydroxyheptyl)cyclopentane-1,3-diol.
| Compound Name | (1S,3R,4R,5R)-4-(4-ethenyl-4-hydroxydec-1-enyl)-5-(7-hydroxyheptyl)cyclopentane-1,3-diol |
|---|---|
| PubChem CID | 54040042 |
| Molecular Formula | C24H44O4 |
| Molecular Weight | 396.61 g/mol |
| Exact Mass | 396.32 |
| IUPAC Name | (1S,3R,4R,5R)-4-(4-ethenyl-4-hydroxydec-1-enyl)-5-(7-hydroxyheptyl)cyclopentane-1,3-diol |
| SMILES | C=CC(O)(CC=C[C@@H]1[C@@H](CCCCCCCO)[C@@H](O)C[C@H]1O)CCCCCC |
| InChI | InChI=1S/C24H44O4/c1-3-5-6-11-16-24(28,4-2)17-13-15-21-20(22(26)19-23(21)27)14-10-8-7-9-12-18-25/h4,13,15,20-23,25-28H,2-3,5-12,14,16-19H2,1H3/t20-,21-,22+,23-,24?/m1/s1 |
| InChIKey | LLRFJVZLJLMWMS-MLYSRARTSA-N |
| XLogP | 4.51 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.61 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|