C23H38O5 — CID 57034638
7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-(4-hydroxy-4-prop-2-ynyloct-1-enyl)cyclopentyl]heptanoic acid (PubChem CID 57034638) has the molecular formula C23H38O5 and a molecular weight of 394.55 g/mol. Its IUPAC name is 7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-(4-hydroxy-4-prop-2-ynyloct-1-enyl)cyclopentyl]heptanoic acid.
| Compound Name | 7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-(4-hydroxy-4-prop-2-ynyloct-1-enyl)cyclopentyl]heptanoic acid |
|---|---|
| PubChem CID | 57034638 |
| Molecular Formula | C23H38O5 |
| Molecular Weight | 394.55 g/mol |
| Exact Mass | 394.27 |
| IUPAC Name | 7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-(4-hydroxy-4-prop-2-ynyloct-1-enyl)cyclopentyl]heptanoic acid |
| SMILES | C#CCC(O)(CC=C[C@@H]1[C@@H](CCCCCCC(=O)O)[C@@H](O)C[C@H]1O)CCCC |
| InChI | InChI=1S/C23H38O5/c1-3-5-15-23(28,14-4-2)16-10-12-19-18(20(24)17-21(19)25)11-8-6-7-9-13-22(26)27/h2,10,12,18-21,24-25,28H,3,5-9,11,13-17H2,1H3,(H,26,27)/t18-,19-,20+,21-,23?/m1/s1 |
| InChIKey | OWGCMKDEJWXCAN-OCAHFIFXSA-N |
| XLogP | 3.66 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.55 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|