C25H46O3Si — CID 57316398
(1R,3S,4R,5R)-4-heptyl-5-[4-hydroxy-4-(2-trimethylsilylethynyl)oct-1-enyl]cyclopentane-1,3-diol (PubChem CID 57316398) has the molecular formula C25H46O3Si and a molecular weight of 422.73 g/mol. Its IUPAC name is (1R,3S,4R,5R)-4-heptyl-5-[4-hydroxy-4-(2-trimethylsilylethynyl)oct-1-enyl]cyclopentane-1,3-diol.
| Compound Name | (1R,3S,4R,5R)-4-heptyl-5-[4-hydroxy-4-(2-trimethylsilylethynyl)oct-1-enyl]cyclopentane-1,3-diol |
|---|---|
| PubChem CID | 57316398 |
| Molecular Formula | C25H46O3Si |
| Molecular Weight | 422.73 g/mol |
| Exact Mass | 422.32 |
| IUPAC Name | (1R,3S,4R,5R)-4-heptyl-5-[4-hydroxy-4-(2-trimethylsilylethynyl)oct-1-enyl]cyclopentane-1,3-diol |
| SMILES | CCCCCCC[C@@H]1[C@@H](C=CCC(O)(C#C[Si](C)(C)C)CCCC)[C@H](O)C[C@@H]1O |
| InChI | InChI=1S/C25H46O3Si/c1-6-8-10-11-12-14-21-22(24(27)20-23(21)26)15-13-17-25(28,16-9-7-2)18-19-29(3,4)5/h13,15,21-24,26-28H,6-12,14,16-17,20H2,1-5H3/t21-,22-,23+,24-,25?/m1/s1 |
| InChIKey | YPMRWJNQIFFMJN-BIFUOPDKSA-N |
| XLogP | 5.45 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.73 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|