C24H42O5S — CID 70630863
methyl 2-[4-[(1R,2R,3R,5R)-2-(4-cyclopropyl-4-hydroxynon-1-enyl)-3,5-dihydroxycyclopentyl]butylsulfanyl]acetate (PubChem CID 70630863) has the molecular formula C24H42O5S and a molecular weight of 442.66 g/mol. Its IUPAC name is methyl 2-[4-[(1R,2R,3R,5R)-2-(4-cyclopropyl-4-hydroxynon-1-enyl)-3,5-dihydroxycyclopentyl]butylsulfanyl]acetate.
| Compound Name | methyl 2-[4-[(1R,2R,3R,5R)-2-(4-cyclopropyl-4-hydroxynon-1-enyl)-3,5-dihydroxycyclopentyl]butylsulfanyl]acetate |
|---|---|
| PubChem CID | 70630863 |
| Molecular Formula | C24H42O5S |
| Molecular Weight | 442.66 g/mol |
| Exact Mass | 442.28 |
| IUPAC Name | methyl 2-[4-[(1R,2R,3R,5R)-2-(4-cyclopropyl-4-hydroxynon-1-enyl)-3,5-dihydroxycyclopentyl]butylsulfanyl]acetate |
| SMILES | CCCCCC(O)(CC=C[C@@H]1[C@@H](CCCCSCC(=O)OC)[C@H](O)C[C@H]1O)C1CC1 |
| InChI | InChI=1S/C24H42O5S/c1-3-4-6-13-24(28,18-11-12-18)14-8-10-20-19(21(25)16-22(20)26)9-5-7-15-30-17-23(27)29-2/h8,10,18-22,25-26,28H,3-7,9,11-17H2,1-2H3/t19-,20-,21-,22-,24?/m1/s1 |
| InChIKey | VEUWEGLNLSLCOC-DEIPETCYSA-N |
| XLogP | 4.09 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.66 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|