C13H24O3 — CID 7001548
methyl 2-[(1R,2R,3S)-3-hydroxy-2-pentylcyclopentyl]acetate (PubChem CID 7001548) has the molecular formula C13H24O3 and a molecular weight of 228.33 g/mol. Its IUPAC name is methyl 2-[(1R,2R,3S)-3-hydroxy-2-pentylcyclopentyl]acetate.
| Compound Name | methyl 2-[(1R,2R,3S)-3-hydroxy-2-pentylcyclopentyl]acetate |
|---|---|
| PubChem CID | 7001548 |
| Molecular Formula | C13H24O3 |
| Molecular Weight | 228.33 g/mol |
| Exact Mass | 228.17 |
| IUPAC Name | methyl 2-[(1R,2R,3S)-3-hydroxy-2-pentylcyclopentyl]acetate |
| SMILES | CCCCC[C@@H]1[C@@H](CC(=O)OC)CC[C@@H]1O |
| InChI | InChI=1S/C13H24O3/c1-3-4-5-6-11-10(7-8-12(11)14)9-13(15)16-2/h10-12,14H,3-9H2,1-2H3/t10-,11-,12+/m1/s1 |
| InChIKey | DZWZEZICFCEJOT-UTUOFQBUSA-N |
| XLogP | 2.52 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.33 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|