C12H24N2O2 — CID 7296014
2-[(1R,2S,3R)-3-hydroxy-2-pentylcyclopentyl]acetohydrazide (PubChem CID 7296014) has the molecular formula C12H24N2O2 and a molecular weight of 228.34 g/mol. Its IUPAC name is 2-[(1R,2S,3R)-3-hydroxy-2-pentylcyclopentyl]acetohydrazide.
| Compound Name | 2-[(1R,2S,3R)-3-hydroxy-2-pentylcyclopentyl]acetohydrazide |
|---|---|
| PubChem CID | 7296014 |
| Molecular Formula | C12H24N2O2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.18 |
| IUPAC Name | 2-[(1R,2S,3R)-3-hydroxy-2-pentylcyclopentyl]acetohydrazide |
| SMILES | CCCCC[C@H]1[C@@H](CC(=O)NN)CC[C@H]1O |
| InChI | InChI=1S/C12H24N2O2/c1-2-3-4-5-10-9(6-7-11(10)15)8-12(16)14-13/h9-11,15H,2-8,13H2,1H3,(H,14,16)/t9-,10+,11-/m1/s1 |
| InChIKey | LEMDCLIXAOKCTJ-OUAUKWLOSA-N |
| XLogP | 1.33 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|