About Cyclopentaneacetic acid, 3-hydroxy-2-pentyl-, sodium salt (1:1)
Cyclopentaneacetic acid, 3-hydroxy-2-pentyl-, sodium salt (1:1) (PubChem CID 126511471) has the molecular formula C12H22NaO3
and a molecular weight of 237.29 g/mol.
Analyze Cyclopentaneacetic acid, 3-hydroxy-2-pentyl-, sodium salt (1:1) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Cyclopentaneacetic acid, 3-hydroxy-2-pentyl-, sodium salt (1:1)?
The IUPAC name of Cyclopentaneacetic acid, 3-hydroxy-2-pentyl-, sodium salt (1:1) (CID 126511471) is not available.
What is the SMILES notation for Cyclopentaneacetic acid, 3-hydroxy-2-pentyl-, sodium salt (1:1)?
The canonical SMILES for Cyclopentaneacetic acid, 3-hydroxy-2-pentyl-, sodium salt (1:1) is CCCCCC1C(O)CCC1CC(=O)O.[Na].
What is the InChIKey of Cyclopentaneacetic acid, 3-hydroxy-2-pentyl-, sodium salt (1:1)?
The InChIKey is OHDAJXQQDQVTGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22O3.Na/c1-2-3-4-5-10-9(8-12(14)15)6-7-11(10)13;/h9-11,13H,2-8H2,1H3,(H,14,15);.
What are the key properties of Cyclopentaneacetic acid, 3-hydroxy-2-pentyl-, sodium salt (1:1)?
Cyclopentaneacetic acid, 3-hydroxy-2-pentyl-, sodium salt (1:1) has a molecular weight of 237.29 g/mol, XLogP of 2.05, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for Cyclopentaneacetic acid, 3-hydroxy-2-pentyl-, sodium salt (1:1) is sourced from PubChem (CID 126511471), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).