C19H36O4S — CID 18595025
2-[4-[(1R,2S,5S)-2-hydroxy-5-(3-hydroxyoctyl)cyclopentyl]butylsulfanyl]acetic acid (PubChem CID 18595025) has the molecular formula C19H36O4S and a molecular weight of 360.56 g/mol. Its IUPAC name is 2-[4-[(1R,2S,5S)-2-hydroxy-5-(3-hydroxyoctyl)cyclopentyl]butylsulfanyl]acetic acid.
| Compound Name | 2-[4-[(1R,2S,5S)-2-hydroxy-5-(3-hydroxyoctyl)cyclopentyl]butylsulfanyl]acetic acid |
|---|---|
| PubChem CID | 18595025 |
| Molecular Formula | C19H36O4S |
| Molecular Weight | 360.56 g/mol |
| Exact Mass | 360.23 |
| IUPAC Name | 2-[4-[(1R,2S,5S)-2-hydroxy-5-(3-hydroxyoctyl)cyclopentyl]butylsulfanyl]acetic acid |
| SMILES | CCCCCC(O)CC[C@H]1CC[C@H](O)[C@@H]1CCCCSCC(=O)O |
| InChI | InChI=1S/C19H36O4S/c1-2-3-4-7-16(20)11-9-15-10-12-18(21)17(15)8-5-6-13-24-14-19(22)23/h15-18,20-21H,2-14H2,1H3,(H,22,23)/t15-,16?,17+,18-/m0/s1 |
| InChIKey | WCQPHIGLNPKYIS-WOPUZOFWSA-N |
| XLogP | 4.08 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.56 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|