C21H40O3S — CID 18594946
methyl 7-[(1R,2S,5R)-2-hydroxy-5-(3-sulfanyloctyl)cyclopentyl]heptanoate (PubChem CID 18594946) has the molecular formula C21H40O3S and a molecular weight of 372.62 g/mol. Its IUPAC name is methyl 7-[(1R,2S,5R)-2-hydroxy-5-(3-sulfanyloctyl)cyclopentyl]heptanoate.
| Compound Name | methyl 7-[(1R,2S,5R)-2-hydroxy-5-(3-sulfanyloctyl)cyclopentyl]heptanoate |
|---|---|
| PubChem CID | 18594946 |
| Molecular Formula | C21H40O3S |
| Molecular Weight | 372.62 g/mol |
| Exact Mass | 372.27 |
| IUPAC Name | methyl 7-[(1R,2S,5R)-2-hydroxy-5-(3-sulfanyloctyl)cyclopentyl]heptanoate |
| SMILES | CCCCCC(S)CC[C@H]1CC[C@H](O)[C@@H]1CCCCCCC(=O)OC |
| InChI | InChI=1S/C21H40O3S/c1-3-4-7-10-18(25)15-13-17-14-16-20(22)19(17)11-8-5-6-9-12-21(23)24-2/h17-20,22,25H,3-16H2,1-2H3/t17-,18?,19+,20-/m0/s1 |
| InChIKey | XYFAPZGFZFAPBY-XGKJMYGNSA-N |
| XLogP | 5.55 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.62 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|