About methyl 11-chlorohexadecanoate
methyl 11-chlorohexadecanoate (PubChem CID 13234969) has the molecular formula C17H33ClO2
and a molecular weight of 304.90 g/mol. Its IUPAC name is methyl 11-chlorohexadecanoate.
Molecular Properties
| Compound Name | methyl 11-chlorohexadecanoate |
| PubChem CID | 13234969 |
| Molecular Formula | C17H33ClO2 |
| Molecular Weight | 304.90 g/mol |
| Exact Mass | 304.22 |
| IUPAC Name | methyl 11-chlorohexadecanoate |
| SMILES | CCCCCC(Cl)CCCCCCCCCC(=O)OC |
| InChI | InChI=1S/C17H33ClO2/c1-3-4-10-13-16(18)14-11-8-6-5-7-9-12-15-17(19)20-2/h16H,3-15H2,1-2H3 |
| InChIKey | OVMMQIAUGUHAIF-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 304.90 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze methyl 11-chlorohexadecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 11-chlorohexadecanoate?
The IUPAC name of methyl 11-chlorohexadecanoate (CID 13234969) is methyl 11-chlorohexadecanoate.
What is the SMILES notation for methyl 11-chlorohexadecanoate?
The canonical SMILES for methyl 11-chlorohexadecanoate is CCCCCC(Cl)CCCCCCCCCC(=O)OC.
What is the InChIKey of methyl 11-chlorohexadecanoate?
The InChIKey is OVMMQIAUGUHAIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H33ClO2/c1-3-4-10-13-16(18)14-11-8-6-5-7-9-12-15-17(19)20-2/h16H,3-15H2,1-2H3.
What are the key properties of methyl 11-chlorohexadecanoate?
methyl 11-chlorohexadecanoate has a molecular weight of 304.90 g/mol, XLogP of 5.86, 14 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 11-chlorohexadecanoate is sourced from PubChem (CID 13234969), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).