About methyl 7,11-dichlorododecanoate
methyl 7,11-dichlorododecanoate (PubChem CID 101278235) has the molecular formula C13H24Cl2O2
and a molecular weight of 283.24 g/mol. Its IUPAC name is methyl 7,11-dichlorododecanoate.
Molecular Properties
| Compound Name | methyl 7,11-dichlorododecanoate |
| PubChem CID | 101278235 |
| Molecular Formula | C13H24Cl2O2 |
| Molecular Weight | 283.24 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | methyl 7,11-dichlorododecanoate |
| SMILES | COC(=O)CCCCCC(Cl)CCCC(C)Cl |
| InChI | InChI=1S/C13H24Cl2O2/c1-11(14)7-6-9-12(15)8-4-3-5-10-13(16)17-2/h11-12H,3-10H2,1-2H3 |
| InChIKey | VODCNCKRNMCALT-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.24 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze methyl 7,11-dichlorododecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 7,11-dichlorododecanoate?
The IUPAC name of methyl 7,11-dichlorododecanoate (CID 101278235) is methyl 7,11-dichlorododecanoate.
What is the SMILES notation for methyl 7,11-dichlorododecanoate?
The canonical SMILES for methyl 7,11-dichlorododecanoate is COC(=O)CCCCCC(Cl)CCCC(C)Cl.
What is the InChIKey of methyl 7,11-dichlorododecanoate?
The InChIKey is VODCNCKRNMCALT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24Cl2O2/c1-11(14)7-6-9-12(15)8-4-3-5-10-13(16)17-2/h11-12H,3-10H2,1-2H3.
What are the key properties of methyl 7,11-dichlorododecanoate?
methyl 7,11-dichlorododecanoate has a molecular weight of 283.24 g/mol, XLogP of 4.51, 10 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 7,11-dichlorododecanoate is sourced from PubChem (CID 101278235), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).