C24H44O5 — CID 57192223
propan-2-yl 7-[(1R,2S,5S)-2-hydroxy-5-octylcyclopentyl]-2-methoxy-3-oxoheptanoate (PubChem CID 57192223) has the molecular formula C24H44O5 and a molecular weight of 412.61 g/mol. Its IUPAC name is propan-2-yl 7-[(1R,2S,5S)-2-hydroxy-5-octylcyclopentyl]-2-methoxy-3-oxoheptanoate.
| Compound Name | propan-2-yl 7-[(1R,2S,5S)-2-hydroxy-5-octylcyclopentyl]-2-methoxy-3-oxoheptanoate |
|---|---|
| PubChem CID | 57192223 |
| Molecular Formula | C24H44O5 |
| Molecular Weight | 412.61 g/mol |
| Exact Mass | 412.32 |
| IUPAC Name | propan-2-yl 7-[(1R,2S,5S)-2-hydroxy-5-octylcyclopentyl]-2-methoxy-3-oxoheptanoate |
| SMILES | CCCCCCCC[C@H]1CC[C@H](O)[C@@H]1CCCCC(=O)C(OC)C(=O)OC(C)C |
| InChI | InChI=1S/C24H44O5/c1-5-6-7-8-9-10-13-19-16-17-21(25)20(19)14-11-12-15-22(26)23(28-4)24(27)29-18(2)3/h18-21,23,25H,5-17H2,1-4H3/t19-,20+,21-,23?/m0/s1 |
| InChIKey | BTEAJPACKGUWKO-XXJJDXCVSA-N |
| XLogP | 5.22 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.61 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|