C28H50O6 — CID 57244267
ethyl 2-(2-hydroxyethoxy)-7-[(1R,2S,5S)-2-hydroxy-5-(5-methylundec-10-enyl)cyclopentyl]-3-oxoheptanoate (PubChem CID 57244267) has the molecular formula C28H50O6 and a molecular weight of 482.70 g/mol. Its IUPAC name is ethyl 2-(2-hydroxyethoxy)-7-[(1R,2S,5S)-2-hydroxy-5-(5-methylundec-10-enyl)cyclopentyl]-3-oxoheptanoate.
| Compound Name | ethyl 2-(2-hydroxyethoxy)-7-[(1R,2S,5S)-2-hydroxy-5-(5-methylundec-10-enyl)cyclopentyl]-3-oxoheptanoate |
|---|---|
| PubChem CID | 57244267 |
| Molecular Formula | C28H50O6 |
| Molecular Weight | 482.70 g/mol |
| Exact Mass | 482.36 |
| IUPAC Name | ethyl 2-(2-hydroxyethoxy)-7-[(1R,2S,5S)-2-hydroxy-5-(5-methylundec-10-enyl)cyclopentyl]-3-oxoheptanoate |
| SMILES | C=CCCCCC(C)CCCC[C@H]1CC[C@H](O)[C@@H]1CCCCC(=O)C(OCCO)C(=O)OCC |
| InChI | InChI=1S/C28H50O6/c1-4-6-7-8-13-22(3)14-9-10-15-23-18-19-25(30)24(23)16-11-12-17-26(31)27(34-21-20-29)28(32)33-5-2/h4,22-25,27,29-30H,1,5-21H2,2-3H3/t22?,23-,24+,25-,27?/m0/s1 |
| InChIKey | JWVYKCWOOTYWJQ-AVMHPANRSA-N |
| XLogP | 5.39 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.70 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|