C21H40O4 — CID 70572049
8-[(1S,2R)-3-hydroxy-2-(4-hydroxyoctyl)cyclopentyl]oct-2-ene-1,2-diol (PubChem CID 70572049) has the molecular formula C21H40O4 and a molecular weight of 356.55 g/mol. Its IUPAC name is 8-[(1S,2R)-3-hydroxy-2-(4-hydroxyoctyl)cyclopentyl]oct-2-ene-1,2-diol.
| Compound Name | 8-[(1S,2R)-3-hydroxy-2-(4-hydroxyoctyl)cyclopentyl]oct-2-ene-1,2-diol |
|---|---|
| PubChem CID | 70572049 |
| Molecular Formula | C21H40O4 |
| Molecular Weight | 356.55 g/mol |
| Exact Mass | 356.29 |
| IUPAC Name | 8-[(1S,2R)-3-hydroxy-2-(4-hydroxyoctyl)cyclopentyl]oct-2-ene-1,2-diol |
| SMILES | CCCCC(O)CCC[C@H]1C(O)CC[C@@H]1CCCCCC=C(O)CO |
| InChI | InChI=1S/C21H40O4/c1-2-3-10-18(23)12-8-13-20-17(14-15-21(20)25)9-6-4-5-7-11-19(24)16-22/h11,17-18,20-25H,2-10,12-16H2,1H3/t17-,18?,20+,21?/m0/s1 |
| InChIKey | FIJZTZAGFWQEMO-QXWDQEIOSA-N |
| XLogP | 4.48 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.55 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|