C36H70O6 — CID 91189495
8-[3-(7-carboxyheptyl)-2-heptyl-4-hexylcyclohexyl]octanoic acid;methanediol (PubChem CID 91189495) has the molecular formula C36H70O6 and a molecular weight of 598.95 g/mol. Its IUPAC name is 8-[3-(7-carboxyheptyl)-2-heptyl-4-hexylcyclohexyl]octanoic acid;methanediol.
| Compound Name | 8-[3-(7-carboxyheptyl)-2-heptyl-4-hexylcyclohexyl]octanoic acid;methanediol |
|---|---|
| PubChem CID | 91189495 |
| Molecular Formula | C36H70O6 |
| Molecular Weight | 598.95 g/mol |
| Exact Mass | 598.52 |
| IUPAC Name | 8-[3-(7-carboxyheptyl)-2-heptyl-4-hexylcyclohexyl]octanoic acid;methanediol |
| SMILES | CCCCCCCC1C(CCCCCCCC(=O)O)CCC(CCCCCC)C1CCCCCCCC(=O)O.OCO |
| InChI | InChI=1S/C35H66O4.CH4O2/c1-3-5-7-11-18-24-32-31(23-17-12-9-14-20-26-34(36)37)29-28-30(22-16-8-6-4-2)33(32)25-19-13-10-15-21-27-35(38)39;2-1-3/h30-33H,3-29H2,1-2H3,(H,36,37)(H,38,39);2-3H,1H2 |
| InChIKey | NNZQGJMMRAQDKQ-UHFFFAOYSA-N |
| XLogP | 10.14 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.95 |
| LogP ≤ 5 | 10.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|