C36H66O4 — CID 20626771
8-[1-(7-carboxyheptyl)-6,7-dipentyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]octanoic acid (PubChem CID 20626771) has the molecular formula C36H66O4 and a molecular weight of 562.92 g/mol. Its IUPAC name is 8-[1-(7-carboxyheptyl)-6,7-dipentyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]octanoic acid.
| Compound Name | 8-[1-(7-carboxyheptyl)-6,7-dipentyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]octanoic acid |
|---|---|
| PubChem CID | 20626771 |
| Molecular Formula | C36H66O4 |
| Molecular Weight | 562.92 g/mol |
| Exact Mass | 562.50 |
| IUPAC Name | 8-[1-(7-carboxyheptyl)-6,7-dipentyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]octanoic acid |
| SMILES | CCCCCC1CC2CCC(CCCCCCCC(=O)O)C(CCCCCCCC(=O)O)C2CC1CCCCC |
| InChI | InChI=1S/C36H66O4/c1-3-5-13-20-30-27-32-26-25-29(19-15-9-7-11-17-23-35(37)38)33(22-16-10-8-12-18-24-36(39)40)34(32)28-31(30)21-14-6-4-2/h29-34H,3-28H2,1-2H3,(H,37,38)(H,39,40) |
| InChIKey | MJOQWROQVQWLJQ-UHFFFAOYSA-N |
| XLogP | 11.06 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.92 |
| LogP ≤ 5 | 11.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|