C18H33NO3 — CID 88633091
7-[(1R,2S)-2-hexyl-5-hydroxyiminocyclopentyl]heptanoic acid (PubChem CID 88633091) has the molecular formula C18H33NO3 and a molecular weight of 311.47 g/mol. Its IUPAC name is 7-[(1R,2S)-2-hexyl-5-hydroxyiminocyclopentyl]heptanoic acid.
| Compound Name | 7-[(1R,2S)-2-hexyl-5-hydroxyiminocyclopentyl]heptanoic acid |
|---|---|
| PubChem CID | 88633091 |
| Molecular Formula | C18H33NO3 |
| Molecular Weight | 311.47 g/mol |
| Exact Mass | 311.25 |
| IUPAC Name | 7-[(1R,2S)-2-hexyl-5-hydroxyiminocyclopentyl]heptanoic acid |
| SMILES | CCCCCC[C@H]1CCC(=NO)[C@@H]1CCCCCCC(=O)O |
| InChI | InChI=1S/C18H33NO3/c1-2-3-4-7-10-15-13-14-17(19-22)16(15)11-8-5-6-9-12-18(20)21/h15-16,22H,2-14H2,1H3,(H,20,21)/t15-,16+/m0/s1 |
| InChIKey | DITKDOCNJFCDMM-JKSUJKDBSA-N |
| XLogP | 5.24 |
| TPSA | 69.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.47 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|