C20H35NO4 — CID 11875331
7-[(1S,2E,5S)-2-hydroxyimino-5-[(E,3S)-3-hydroxyoct-1-enyl]cyclopentyl]heptanoic acid (PubChem CID 11875331) has the molecular formula C20H35NO4 and a molecular weight of 353.50 g/mol. Its IUPAC name is 7-[(1S,2E,5S)-2-hydroxyimino-5-[(E,3S)-3-hydroxyoct-1-enyl]cyclopentyl]heptanoic acid.
| Compound Name | 7-[(1S,2E,5S)-2-hydroxyimino-5-[(E,3S)-3-hydroxyoct-1-enyl]cyclopentyl]heptanoic acid |
|---|---|
| PubChem CID | 11875331 |
| Molecular Formula | C20H35NO4 |
| Molecular Weight | 353.50 g/mol |
| Exact Mass | 353.26 |
| IUPAC Name | 7-[(1S,2E,5S)-2-hydroxyimino-5-[(E,3S)-3-hydroxyoct-1-enyl]cyclopentyl]heptanoic acid |
| SMILES | CCCCC[C@H](O)/C=C/[C@@H]1CC/C(=N\O)[C@H]1CCCCCCC(=O)O |
| InChI | InChI=1S/C20H35NO4/c1-2-3-6-9-17(22)14-12-16-13-15-19(21-25)18(16)10-7-4-5-8-11-20(23)24/h12,14,16-18,22,25H,2-11,13,15H2,1H3,(H,23,24)/b14-12+,21-19+/t16-,17+,18+/m1/s1 |
| InChIKey | VVNPPIUUPJFWII-FJEJTWGWSA-N |
| XLogP | 4.77 |
| TPSA | 90.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.50 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|