C20H34O4S — CID 90679496
2-[5-[(1R)-2-[(E,3S)-3-hydroxyoct-1-enyl]-5-oxocyclopentyl]pentylsulfanyl]acetic acid (PubChem CID 90679496) has the molecular formula C20H34O4S and a molecular weight of 370.56 g/mol. Its IUPAC name is 2-[5-[(1R)-2-[(E,3S)-3-hydroxyoct-1-enyl]-5-oxocyclopentyl]pentylsulfanyl]acetic acid.
| Compound Name | 2-[5-[(1R)-2-[(E,3S)-3-hydroxyoct-1-enyl]-5-oxocyclopentyl]pentylsulfanyl]acetic acid |
|---|---|
| PubChem CID | 90679496 |
| Molecular Formula | C20H34O4S |
| Molecular Weight | 370.56 g/mol |
| Exact Mass | 370.22 |
| IUPAC Name | 2-[5-[(1R)-2-[(E,3S)-3-hydroxyoct-1-enyl]-5-oxocyclopentyl]pentylsulfanyl]acetic acid |
| SMILES | CCCCC[C@H](O)/C=C/C1CCC(=O)[C@@H]1CCCCCSCC(=O)O |
| InChI | InChI=1S/C20H34O4S/c1-2-3-5-8-17(21)12-10-16-11-13-19(22)18(16)9-6-4-7-14-25-15-20(23)24/h10,12,16-18,21H,2-9,11,13-15H2,1H3,(H,23,24)/b12-10+/t16?,17-,18+/m0/s1 |
| InChIKey | XSDONMUCMOXKHQ-QIQHFIHWSA-N |
| XLogP | 4.46 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.56 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|