C28H43NO3 — CID 135639142
7-[(1R,2R)-2-[(E,3R)-3-hydroxyoct-1-enyl]-5-oxocyclopentyl]-N-(2-phenylethyl)heptanamide (PubChem CID 135639142) has the molecular formula C28H43NO3 and a molecular weight of 441.66 g/mol. Its IUPAC name is 7-[(1R,2R)-2-[(E,3R)-3-hydroxyoct-1-enyl]-5-oxocyclopentyl]-N-(2-phenylethyl)heptanamide.
| Compound Name | 7-[(1R,2R)-2-[(E,3R)-3-hydroxyoct-1-enyl]-5-oxocyclopentyl]-N-(2-phenylethyl)heptanamide |
|---|---|
| PubChem CID | 135639142 |
| Molecular Formula | C28H43NO3 |
| Molecular Weight | 441.66 g/mol |
| Exact Mass | 441.32 |
| IUPAC Name | 7-[(1R,2R)-2-[(E,3R)-3-hydroxyoct-1-enyl]-5-oxocyclopentyl]-N-(2-phenylethyl)heptanamide |
| SMILES | CCCCC[C@@H](O)/C=C/[C@H]1CCC(=O)[C@@H]1CCCCCCC(=O)NCCc1ccccc1 |
| InChI | InChI=1S/C28H43NO3/c1-2-3-7-14-25(30)19-17-24-18-20-27(31)26(24)15-10-4-5-11-16-28(32)29-22-21-23-12-8-6-9-13-23/h6,8-9,12-13,17,19,24-26,30H,2-5,7,10-11,14-16,18,20-22H2,1H3,(H,29,32)/b19-17+/t24-,25+,26+/m0/s1 |
| InChIKey | COGZGMNTPXRPRY-LFYATDHWSA-N |
| XLogP | 5.78 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.66 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|