C31H47ClN2O3 — CID 71964303
trans-(2R,3R)-2-[7-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]-7-oxoheptyl]-3-[(3R)-3-hydroxyoct-1-enyl]cyclopentan-1-one (PubChem CID 71964303) has the molecular formula C31H47ClN2O3 and a molecular weight of 531.18 g/mol. Its IUPAC name is trans-(2R,3R)-2-[7-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]-7-oxoheptyl]-3-[(3R)-3-hydroxyoct-1-enyl]cyclopentan-1-one.
| Compound Name | trans-(2R,3R)-2-[7-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]-7-oxoheptyl]-3-[(3R)-3-hydroxyoct-1-enyl]cyclopentan-1-one |
|---|---|
| PubChem CID | 71964303 |
| Molecular Formula | C31H47ClN2O3 |
| Molecular Weight | 531.18 g/mol |
| Exact Mass | 530.33 |
| IUPAC Name | trans-(2R,3R)-2-[7-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]-7-oxoheptyl]-3-[(3R)-3-hydroxyoct-1-enyl]cyclopentan-1-one |
| SMILES | CCCCC[C@@H](O)C=C[C@H]1CCC(=O)[C@@H]1CCCCCCC(=O)N1CCN(c2cc(Cl)ccc2C)CC1 |
| InChI | InChI=1S/C31H47ClN2O3/c1-3-4-7-10-27(35)17-14-25-15-18-30(36)28(25)11-8-5-6-9-12-31(37)34-21-19-33(20-22-34)29-23-26(32)16-13-24(29)2/h13-14,16-17,23,25,27-28,35H,3-12,15,18-22H2,1-2H3/t25-,27+,28+/m0/s1 |
| InChIKey | SWQUUIOQUKQVSV-KJYTXNCISA-N |
| XLogP | 6.73 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.18 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|