C32H48N2O5 — CID 162941102
cis-(2R,3S)-2-[7-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-7-oxoheptyl]-3-[(3S)-3-hydroxyoct-1-enyl]cyclopentan-1-one (PubChem CID 162941102) has the molecular formula C32H48N2O5 and a molecular weight of 540.75 g/mol. Its IUPAC name is cis-(2R,3S)-2-[7-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-7-oxoheptyl]-3-[(3S)-3-hydroxyoct-1-enyl]cyclopentan-1-one.
| Compound Name | cis-(2R,3S)-2-[7-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-7-oxoheptyl]-3-[(3S)-3-hydroxyoct-1-enyl]cyclopentan-1-one |
|---|---|
| PubChem CID | 162941102 |
| Molecular Formula | C32H48N2O5 |
| Molecular Weight | 540.75 g/mol |
| Exact Mass | 540.36 |
| IUPAC Name | cis-(2R,3S)-2-[7-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-7-oxoheptyl]-3-[(3S)-3-hydroxyoct-1-enyl]cyclopentan-1-one |
| SMILES | CCCCC[C@H](O)C=C[C@@H]1CCC(=O)[C@@H]1CCCCCCC(=O)N1CCN(Cc2ccc3c(c2)OCO3)CC1 |
| InChI | InChI=1S/C32H48N2O5/c1-2-3-6-9-27(35)15-13-26-14-16-29(36)28(26)10-7-4-5-8-11-32(37)34-20-18-33(19-21-34)23-25-12-17-30-31(22-25)39-24-38-30/h12-13,15,17,22,26-28,35H,2-11,14,16,18-21,23-24H2,1H3/t26-,27+,28-/m1/s1 |
| InChIKey | MZKITDQNKMELNP-OZNIXHKMSA-N |
| XLogP | 5.49 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.75 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|