C18H26N2O3 — CID 3309155
1-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]hexan-1-one (PubChem CID 3309155) has the molecular formula C18H26N2O3 and a molecular weight of 318.42 g/mol. Its IUPAC name is 1-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]hexan-1-one.
| Compound Name | 1-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]hexan-1-one |
|---|---|
| PubChem CID | 3309155 |
| Molecular Formula | C18H26N2O3 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.19 |
| IUPAC Name | 1-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]hexan-1-one |
| SMILES | CCCCCC(=O)N1CCN(Cc2ccc3c(c2)OCO3)CC1 |
| InChI | InChI=1S/C18H26N2O3/c1-2-3-4-5-18(21)20-10-8-19(9-11-20)13-15-6-7-16-17(12-15)23-14-22-16/h6-7,12H,2-5,8-11,13-14H2,1H3 |
| InChIKey | BZWCGYYIMOJLQT-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|