C21H33N3O2S — CID 3192015
4-(1,3-benzodioxol-5-ylmethyl)-N-octylpiperazine-1-carbothioamide (PubChem CID 3192015) has the molecular formula C21H33N3O2S and a molecular weight of 391.58 g/mol. Its IUPAC name is 4-(1,3-benzodioxol-5-ylmethyl)-N-octylpiperazine-1-carbothioamide.
| Compound Name | 4-(1,3-benzodioxol-5-ylmethyl)-N-octylpiperazine-1-carbothioamide |
|---|---|
| PubChem CID | 3192015 |
| Molecular Formula | C21H33N3O2S |
| Molecular Weight | 391.58 g/mol |
| Exact Mass | 391.23 |
| IUPAC Name | 4-(1,3-benzodioxol-5-ylmethyl)-N-octylpiperazine-1-carbothioamide |
| SMILES | CCCCCCCCNC(=S)N1CCN(Cc2ccc3c(c2)OCO3)CC1 |
| InChI | InChI=1S/C21H33N3O2S/c1-2-3-4-5-6-7-10-22-21(27)24-13-11-23(12-14-24)16-18-8-9-19-20(15-18)26-17-25-19/h8-9,15H,2-7,10-14,16-17H2,1H3,(H,22,27) |
| InChIKey | MPKASMWPKQDYHX-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 36.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.58 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|