C21H25N3O4S2 — CID 19655368
methyl 2-[[4-(1,3-benzodioxol-5-ylmethyl)piperazine-1-carbothioyl]amino]-5-ethylthiophene-3-carboxylate (PubChem CID 19655368) has the molecular formula C21H25N3O4S2 and a molecular weight of 447.58 g/mol. Its IUPAC name is methyl 2-[[4-(1,3-benzodioxol-5-ylmethyl)piperazine-1-carbothioyl]amino]-5-ethylthiophene-3-carboxylate.
| Compound Name | methyl 2-[[4-(1,3-benzodioxol-5-ylmethyl)piperazine-1-carbothioyl]amino]-5-ethylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 19655368 |
| Molecular Formula | C21H25N3O4S2 |
| Molecular Weight | 447.58 g/mol |
| Exact Mass | 447.13 |
| IUPAC Name | methyl 2-[[4-(1,3-benzodioxol-5-ylmethyl)piperazine-1-carbothioyl]amino]-5-ethylthiophene-3-carboxylate |
| SMILES | CCc1cc(C(=O)OC)c(NC(=S)N2CCN(Cc3ccc4c(c3)OCO4)CC2)s1 |
| InChI | InChI=1S/C21H25N3O4S2/c1-3-15-11-16(20(25)26-2)19(30-15)22-21(29)24-8-6-23(7-9-24)12-14-4-5-17-18(10-14)28-13-27-17/h4-5,10-11H,3,6-9,12-13H2,1-2H3,(H,22,29) |
| InChIKey | CEIBAWKOVMGSDD-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 63.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.58 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|