C19H23N3O2S2 — CID 19654364
methyl 5-ethyl-2-[(4-phenylpiperazine-1-carbothioyl)amino]thiophene-3-carboxylate (PubChem CID 19654364) has the molecular formula C19H23N3O2S2 and a molecular weight of 389.55 g/mol. Its IUPAC name is methyl 5-ethyl-2-[(4-phenylpiperazine-1-carbothioyl)amino]thiophene-3-carboxylate.
| Compound Name | methyl 5-ethyl-2-[(4-phenylpiperazine-1-carbothioyl)amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 19654364 |
| Molecular Formula | C19H23N3O2S2 |
| Molecular Weight | 389.55 g/mol |
| Exact Mass | 389.12 |
| IUPAC Name | methyl 5-ethyl-2-[(4-phenylpiperazine-1-carbothioyl)amino]thiophene-3-carboxylate |
| SMILES | CCc1cc(C(=O)OC)c(NC(=S)N2CCN(c3ccccc3)CC2)s1 |
| InChI | InChI=1S/C19H23N3O2S2/c1-3-15-13-16(18(23)24-2)17(26-15)20-19(25)22-11-9-21(10-12-22)14-7-5-4-6-8-14/h4-8,13H,3,9-12H2,1-2H3,(H,20,25) |
| InChIKey | MWBVJJXVYSFSHB-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.55 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|