C20H23N3O2S2 — CID 19654367
methyl 2-[(4-phenylpiperazine-1-carbothioyl)amino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylate (PubChem CID 19654367) has the molecular formula C20H23N3O2S2 and a molecular weight of 401.56 g/mol. Its IUPAC name is methyl 2-[(4-phenylpiperazine-1-carbothioyl)amino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylate.
| Compound Name | methyl 2-[(4-phenylpiperazine-1-carbothioyl)amino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 19654367 |
| Molecular Formula | C20H23N3O2S2 |
| Molecular Weight | 401.56 g/mol |
| Exact Mass | 401.12 |
| IUPAC Name | methyl 2-[(4-phenylpiperazine-1-carbothioyl)amino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylate |
| SMILES | COC(=O)c1c(NC(=S)N2CCN(c3ccccc3)CC2)sc2c1CCC2 |
| InChI | InChI=1S/C20H23N3O2S2/c1-25-19(24)17-15-8-5-9-16(15)27-18(17)21-20(26)23-12-10-22(11-13-23)14-6-3-2-4-7-14/h2-4,6-7H,5,8-13H2,1H3,(H,21,26) |
| InChIKey | JXBBTKWDDYJNIT-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.56 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|