C31H37N3O2S2 — CID 19654340
ethyl 2-[(4-benzhydrylpiperazine-1-carbothioyl)amino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate (PubChem CID 19654340) has the molecular formula C31H37N3O2S2 and a molecular weight of 547.79 g/mol. Its IUPAC name is ethyl 2-[(4-benzhydrylpiperazine-1-carbothioyl)amino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate.
| Compound Name | ethyl 2-[(4-benzhydrylpiperazine-1-carbothioyl)amino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 19654340 |
| Molecular Formula | C31H37N3O2S2 |
| Molecular Weight | 547.79 g/mol |
| Exact Mass | 547.23 |
| IUPAC Name | ethyl 2-[(4-benzhydrylpiperazine-1-carbothioyl)amino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=S)N2CCN(C(c3ccccc3)c3ccccc3)CC2)sc2c1CCCCCC2 |
| InChI | InChI=1S/C31H37N3O2S2/c1-2-36-30(35)27-25-17-11-3-4-12-18-26(25)38-29(27)32-31(37)34-21-19-33(20-22-34)28(23-13-7-5-8-14-23)24-15-9-6-10-16-24/h5-10,13-16,28H,2-4,11-12,17-22H2,1H3,(H,32,37) |
| InChIKey | VLBOCAJXYCSZIH-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.79 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|