C19H28N2O2S2 — CID 3269493
ethyl 2-(azepane-1-carbothioylamino)-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxylate (PubChem CID 3269493) has the molecular formula C19H28N2O2S2 and a molecular weight of 380.58 g/mol. Its IUPAC name is ethyl 2-(azepane-1-carbothioylamino)-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxylate.
| Compound Name | ethyl 2-(azepane-1-carbothioylamino)-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 3269493 |
| Molecular Formula | C19H28N2O2S2 |
| Molecular Weight | 380.58 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | ethyl 2-(azepane-1-carbothioylamino)-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=S)N2CCCCCC2)sc2c1CCCCC2 |
| InChI | InChI=1S/C19H28N2O2S2/c1-2-23-18(22)16-14-10-6-5-7-11-15(14)25-17(16)20-19(24)21-12-8-3-4-9-13-21/h2-13H2,1H3,(H,20,24) |
| InChIKey | HQFBEHFRCIKCHI-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.58 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|