C24H31N3O3S2 — CID 19654572
methyl 2-[[4-(4-methoxyphenyl)piperazine-1-carbothioyl]amino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate (PubChem CID 19654572) has the molecular formula C24H31N3O3S2 and a molecular weight of 473.66 g/mol. Its IUPAC name is methyl 2-[[4-(4-methoxyphenyl)piperazine-1-carbothioyl]amino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate.
| Compound Name | methyl 2-[[4-(4-methoxyphenyl)piperazine-1-carbothioyl]amino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 19654572 |
| Molecular Formula | C24H31N3O3S2 |
| Molecular Weight | 473.66 g/mol |
| Exact Mass | 473.18 |
| IUPAC Name | methyl 2-[[4-(4-methoxyphenyl)piperazine-1-carbothioyl]amino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate |
| SMILES | COC(=O)c1c(NC(=S)N2CCN(c3ccc(OC)cc3)CC2)sc2c1CCCCCC2 |
| InChI | InChI=1S/C24H31N3O3S2/c1-29-18-11-9-17(10-12-18)26-13-15-27(16-14-26)24(31)25-22-21(23(28)30-2)19-7-5-3-4-6-8-20(19)32-22/h9-12H,3-8,13-16H2,1-2H3,(H,25,31) |
| InChIKey | FOOOLXVDTANWRB-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.66 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|