C22H28N4O4S2 — CID 19654582
methyl 5-(dimethylcarbamoyl)-2-[[4-(4-methoxyphenyl)piperazine-1-carbothioyl]amino]-4-methylthiophene-3-carboxylate (PubChem CID 19654582) has the molecular formula C22H28N4O4S2 and a molecular weight of 476.62 g/mol. Its IUPAC name is methyl 5-(dimethylcarbamoyl)-2-[[4-(4-methoxyphenyl)piperazine-1-carbothioyl]amino]-4-methylthiophene-3-carboxylate.
| Compound Name | methyl 5-(dimethylcarbamoyl)-2-[[4-(4-methoxyphenyl)piperazine-1-carbothioyl]amino]-4-methylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 19654582 |
| Molecular Formula | C22H28N4O4S2 |
| Molecular Weight | 476.62 g/mol |
| Exact Mass | 476.16 |
| IUPAC Name | methyl 5-(dimethylcarbamoyl)-2-[[4-(4-methoxyphenyl)piperazine-1-carbothioyl]amino]-4-methylthiophene-3-carboxylate |
| SMILES | COC(=O)c1c(NC(=S)N2CCN(c3ccc(OC)cc3)CC2)sc(C(=O)N(C)C)c1C |
| InChI | InChI=1S/C22H28N4O4S2/c1-14-17(21(28)30-5)19(32-18(14)20(27)24(2)3)23-22(31)26-12-10-25(11-13-26)15-6-8-16(29-4)9-7-15/h6-9H,10-13H2,1-5H3,(H,23,31) |
| InChIKey | ZYWRUXQDRAPUSX-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 74.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.62 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|