C21H27N3O4S2 — CID 19649534
methyl 5-(diethylcarbamoyl)-2-[(4-methoxyphenyl)methylcarbamothioylamino]-4-methylthiophene-3-carboxylate (PubChem CID 19649534) has the molecular formula C21H27N3O4S2 and a molecular weight of 449.60 g/mol. Its IUPAC name is methyl 5-(diethylcarbamoyl)-2-[(4-methoxyphenyl)methylcarbamothioylamino]-4-methylthiophene-3-carboxylate.
| Compound Name | methyl 5-(diethylcarbamoyl)-2-[(4-methoxyphenyl)methylcarbamothioylamino]-4-methylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 19649534 |
| Molecular Formula | C21H27N3O4S2 |
| Molecular Weight | 449.60 g/mol |
| Exact Mass | 449.14 |
| IUPAC Name | methyl 5-(diethylcarbamoyl)-2-[(4-methoxyphenyl)methylcarbamothioylamino]-4-methylthiophene-3-carboxylate |
| SMILES | CCN(CC)C(=O)c1sc(NC(=S)NCc2ccc(OC)cc2)c(C(=O)OC)c1C |
| InChI | InChI=1S/C21H27N3O4S2/c1-6-24(7-2)19(25)17-13(3)16(20(26)28-5)18(30-17)23-21(29)22-12-14-8-10-15(27-4)11-9-14/h8-11H,6-7,12H2,1-5H3,(H2,22,23,29) |
| InChIKey | IMRYQDKTWDIHKB-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.60 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|