C29H31N5O3S2 — CID 2954290
methyl 5-(diethylcarbamoyl)-2-[(1,3-diphenylpyrazol-4-yl)methylcarbamothioylamino]-4-methylthiophene-3-carboxylate (PubChem CID 2954290) has the molecular formula C29H31N5O3S2 and a molecular weight of 561.73 g/mol. Its IUPAC name is methyl 5-(diethylcarbamoyl)-2-[(1,3-diphenylpyrazol-4-yl)methylcarbamothioylamino]-4-methylthiophene-3-carboxylate.
| Compound Name | methyl 5-(diethylcarbamoyl)-2-[(1,3-diphenylpyrazol-4-yl)methylcarbamothioylamino]-4-methylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 2954290 |
| Molecular Formula | C29H31N5O3S2 |
| Molecular Weight | 561.73 g/mol |
| Exact Mass | 561.19 |
| IUPAC Name | methyl 5-(diethylcarbamoyl)-2-[(1,3-diphenylpyrazol-4-yl)methylcarbamothioylamino]-4-methylthiophene-3-carboxylate |
| SMILES | CCN(CC)C(=O)c1sc(NC(=S)NCc2cn(-c3ccccc3)nc2-c2ccccc2)c(C(=O)OC)c1C |
| InChI | InChI=1S/C29H31N5O3S2/c1-5-33(6-2)27(35)25-19(3)23(28(36)37-4)26(39-25)31-29(38)30-17-21-18-34(22-15-11-8-12-16-22)32-24(21)20-13-9-7-10-14-20/h7-16,18H,5-6,17H2,1-4H3,(H2,30,31,38) |
| InChIKey | MVSQHHQQWQFPET-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 88.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.73 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|